C26H31BN4O3 — CID 59166503
2-pyridin-3-yl-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 59166503) has the molecular formula C26H31BN4O3 and a molecular weight of 458.37 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-pyridin-3-yl-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59166503 |
| Molecular Formula | C26H31BN4O3 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-pyridin-3-yl-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2ccc(-c3cnc([C@@H]4CCCN4C(=O)Cc4cccnc4)[nH]3)cc2)OC1(C)C |
| InChI | InChI=1S/C26H31BN4O3/c1-25(2)26(3,4)34-27(33-25)20-11-9-19(10-12-20)21-17-29-24(30-21)22-8-6-14-31(22)23(32)15-18-7-5-13-28-16-18/h5,7,9-13,16-17,22H,6,8,14-15H2,1-4H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | DYPTXUGLSGDUGI-QFIPXVFZSA-N |
| XLogP | 3.68 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|