C27H32BN3O3 — CID 152821357
2-pyridin-3-yl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 152821357) has the molecular formula C27H32BN3O3 and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-pyridin-3-yl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 152821357 |
| Molecular Formula | C27H32BN3O3 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-pyridin-3-yl-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2ccc(C3=CN=C([C@@H]4CCCN4C(=O)Cc4cccnc4)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H32BN3O3/c1-26(2)27(3,4)34-28(33-26)22-11-9-20(10-12-22)21-16-23(30-18-21)24-8-6-14-31(24)25(32)15-19-7-5-13-29-17-19/h5,7,9-13,17-18,24H,6,8,14-16H2,1-4H3/t24-/m0/s1 |
| InChIKey | STWIOLOSRDAZNM-DEOSSOPVSA-N |
| XLogP | 3.80 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|