C28H38BN3O6 — CID 140809241
methyl N-[2-oxo-1-(oxolan-3-yl)-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 140809241) has the molecular formula C28H38BN3O6 and a molecular weight of 523.44 g/mol. Its IUPAC name is methyl N-[2-oxo-1-(oxolan-3-yl)-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[2-oxo-1-(oxolan-3-yl)-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140809241 |
| Molecular Formula | C28H38BN3O6 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | methyl N-[2-oxo-1-(oxolan-3-yl)-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C1CCOC1 |
| InChI | InChI=1S/C28H38BN3O6/c1-27(2)28(3,4)38-29(37-27)21-10-8-18(9-11-21)20-15-22(30-16-20)23-7-6-13-32(23)25(33)24(31-26(34)35-5)19-12-14-36-17-19/h8-11,16,19,23-24H,6-7,12-15,17H2,1-5H3,(H,31,34)/t19?,23-,24?/m0/s1 |
| InChIKey | ADOTZSJGJICWBJ-JWLIYLPMSA-N |
| XLogP | 2.92 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|