C30H41BN2O6 — CID 140809155
methyl N-[1-(oxan-4-yl)-2-oxo-2-[2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 140809155) has the molecular formula C30H41BN2O6 and a molecular weight of 536.48 g/mol. Its IUPAC name is methyl N-[1-(oxan-4-yl)-2-oxo-2-[2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[1-(oxan-4-yl)-2-oxo-2-[2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140809155 |
| Molecular Formula | C30H41BN2O6 |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | methyl N-[1-(oxan-4-yl)-2-oxo-2-[2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopenta-1,3-dien-1-yl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1C1=CC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C1CCOCC1 |
| InChI | InChI=1S/C30H41BN2O6/c1-29(2)30(3,4)39-31(38-29)24-12-10-20(11-13-24)22-8-9-23(19-22)25-7-6-16-33(25)27(34)26(32-28(35)36-5)21-14-17-37-18-15-21/h8-13,21,25-26H,6-7,14-19H2,1-5H3,(H,32,35) |
| InChIKey | FSEJVOFKJLONGL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|