C17H30N2O4 — CID 163669024
methyl N-[(1S)-2-(2-tert-butylpyrrolidin-1-yl)-1-(oxan-4-yl)-2-oxoethyl]carbamate (PubChem CID 163669024) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl N-[(1S)-2-(2-tert-butylpyrrolidin-1-yl)-1-(oxan-4-yl)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[(1S)-2-(2-tert-butylpyrrolidin-1-yl)-1-(oxan-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163669024 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | methyl N-[(1S)-2-(2-tert-butylpyrrolidin-1-yl)-1-(oxan-4-yl)-2-oxoethyl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCCC1C(C)(C)C)C1CCOCC1 |
| InChI | InChI=1S/C17H30N2O4/c1-17(2,3)13-6-5-9-19(13)15(20)14(18-16(21)22-4)12-7-10-23-11-8-12/h12-14H,5-11H2,1-4H3,(H,18,21)/t13?,14-/m0/s1 |
| InChIKey | JAXJMQZAJRXEDP-KZUDCZAMSA-N |
| XLogP | 2.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |