C9H15NO4S2 — CID 123667070
S-sulfanyl 2-(methoxycarbonylamino)-2-(oxan-4-yl)ethanethioate (PubChem CID 123667070) has the molecular formula C9H15NO4S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is S-sulfanyl 2-(methoxycarbonylamino)-2-(oxan-4-yl)ethanethioate.
| Compound Name | S-sulfanyl 2-(methoxycarbonylamino)-2-(oxan-4-yl)ethanethioate |
|---|---|
| PubChem CID | 123667070 |
| Molecular Formula | C9H15NO4S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | S-sulfanyl 2-(methoxycarbonylamino)-2-(oxan-4-yl)ethanethioate |
| SMILES | COC(=O)NC(C(=O)SS)C1CCOCC1 |
| InChI | InChI=1S/C9H15NO4S2/c1-13-9(12)10-7(8(11)16-15)6-2-4-14-5-3-6/h6-7,15H,2-5H2,1H3,(H,10,12) |
| InChIKey | BXBVHUJRYKNAKZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|