C7H11NO5 — CID 86330213
(2R)-2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetic acid (PubChem CID 86330213) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is (2R)-2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetic acid.
| Compound Name | (2R)-2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetic acid |
|---|---|
| PubChem CID | 86330213 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2R)-2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetic acid |
| SMILES | COC(=O)N[C@@H](C(=O)O)C1COC1 |
| InChI | InChI=1S/C7H11NO5/c1-12-7(11)8-5(6(9)10)4-2-13-3-4/h4-5H,2-3H2,1H3,(H,8,11)(H,9,10)/t5-/m1/s1 |
| InChIKey | JPCXGAHSWZKCCO-RXMQYKEDSA-N |
| XLogP | -0.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |