C7H10LiNO5 — CID 59264533
lithium 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate (PubChem CID 59264533) has the molecular formula C7H10LiNO5 and a molecular weight of 195.10 g/mol. Its IUPAC name is lithium 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate.
| Compound Name | lithium 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate |
|---|---|
| PubChem CID | 59264533 |
| Molecular Formula | C7H10LiNO5 |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | lithium 2-(methoxycarbonylamino)-2-(oxetan-3-yl)acetate |
| SMILES | COC(=O)NC(C(=O)[O-])C1COC1.[Li+] |
| InChI | InChI=1S/C7H11NO5.Li/c1-12-7(11)8-5(6(9)10)4-2-13-3-4;/h4-5H,2-3H2,1H3,(H,8,11)(H,9,10);/q;+1/p-1 |
| InChIKey | FFPWOKGITYUQON-UHFFFAOYSA-M |
| XLogP | -4.89 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | -4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |