C10H19NO3 — CID 143630049
ethane;methyl N-(1-cyclopropyl-2-oxopropyl)carbamate (PubChem CID 143630049) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is ethane;methyl N-(1-cyclopropyl-2-oxopropyl)carbamate.
| Compound Name | ethane;methyl N-(1-cyclopropyl-2-oxopropyl)carbamate |
|---|---|
| PubChem CID | 143630049 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethane;methyl N-(1-cyclopropyl-2-oxopropyl)carbamate |
| SMILES | CC.COC(=O)NC(C(C)=O)C1CC1 |
| InChI | InChI=1S/C8H13NO3.C2H6/c1-5(10)7(6-3-4-6)9-8(11)12-2;1-2/h6-7H,3-4H2,1-2H3,(H,9,11);1-2H3 |
| InChIKey | KMSCQBCMSOWDNI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |