C10H17NO3S — CID 158475733
methyl N-[(1S)-1-cyclopropyl-3-methylsulfanyl-2-oxobutyl]carbamate (PubChem CID 158475733) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is methyl N-[(1S)-1-cyclopropyl-3-methylsulfanyl-2-oxobutyl]carbamate.
| Compound Name | methyl N-[(1S)-1-cyclopropyl-3-methylsulfanyl-2-oxobutyl]carbamate |
|---|---|
| PubChem CID | 158475733 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | methyl N-[(1S)-1-cyclopropyl-3-methylsulfanyl-2-oxobutyl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)C(C)SC)C1CC1 |
| InChI | InChI=1S/C10H17NO3S/c1-6(15-3)9(12)8(7-4-5-7)11-10(13)14-2/h6-8H,4-5H2,1-3H3,(H,11,13)/t6?,8-/m0/s1 |
| InChIKey | HGXFOINZWBCKQP-XDKWHASVSA-N |
| XLogP | 1.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |