C9H16N2O4 — CID 123481327
methyl N-[2-amino-1-(oxan-4-yl)-2-oxoethyl]carbamate (PubChem CID 123481327) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl N-[2-amino-1-(oxan-4-yl)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-amino-1-(oxan-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123481327 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | methyl N-[2-amino-1-(oxan-4-yl)-2-oxoethyl]carbamate |
| SMILES | COC(=O)NC(C(N)=O)C1CCOCC1 |
| InChI | InChI=1S/C9H16N2O4/c1-14-9(13)11-7(8(10)12)6-2-4-15-5-3-6/h6-7H,2-5H2,1H3,(H2,10,12)(H,11,13) |
| InChIKey | RVOXPTSAPJCBNG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |