C27H38BN3O6 — CID 140809124
methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 140809124) has the molecular formula C27H38BN3O6 and a molecular weight of 511.43 g/mol. Its IUPAC name is methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809124 |
| Molecular Formula | C27H38BN3O6 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)[C@@H](C)OC |
| InChI | InChI=1S/C27H38BN3O6/c1-17(34-6)23(30-25(33)35-7)24(32)31-14-8-9-22(31)21-15-19(16-29-21)18-10-12-20(13-11-18)28-36-26(2,3)27(4,5)37-28/h10-13,16-17,22-23H,8-9,14-15H2,1-7H3,(H,30,33)/t17-,22+,23+/m1/s1 |
| InChIKey | HRJBYCKTKOYUAF-VSDWSMLSSA-N |
| XLogP | 2.92 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|