C26H36BN3O6 — CID 140809150
methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[[1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]cyclopropyl]amino]butan-2-yl]carbamate (PubChem CID 140809150) has the molecular formula C26H36BN3O6 and a molecular weight of 497.40 g/mol. Its IUPAC name is methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[[1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]cyclopropyl]amino]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[[1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]cyclopropyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809150 |
| Molecular Formula | C26H36BN3O6 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | methyl N-[(2S,3R)-3-methoxy-1-oxo-1-[[1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]cyclopropyl]amino]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)NC1(C2=NC=C(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)C2)CC1)[C@@H](C)OC |
| InChI | InChI=1S/C26H36BN3O6/c1-16(33-6)21(29-23(32)34-7)22(31)30-26(12-13-26)20-14-18(15-28-20)17-8-10-19(11-9-17)27-35-24(2,3)25(4,5)36-27/h8-11,15-16,21H,12-14H2,1-7H3,(H,29,32)(H,30,31)/t16-,21+/m1/s1 |
| InChIKey | IIEFJGMXEXEBSZ-IERDGZPVSA-N |
| XLogP | 2.58 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|