C25H37BN4O5 — CID 91591117
methyl N-[3-methyl-1-oxo-1-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propylamino]butan-2-yl]carbamate (PubChem CID 91591117) has the molecular formula C25H37BN4O5 and a molecular weight of 484.41 g/mol. Its IUPAC name is methyl N-[3-methyl-1-oxo-1-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propylamino]butan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-oxo-1-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 91591117 |
| Molecular Formula | C25H37BN4O5 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | methyl N-[3-methyl-1-oxo-1-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propylamino]butan-2-yl]carbamate |
| SMILES | CCC(NC(=O)C(NC(=O)OC)C(C)C)c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C25H37BN4O5/c1-9-18(29-22(31)20(15(2)3)30-23(32)33-8)21-27-14-19(28-21)16-10-12-17(13-11-16)26-34-24(4,5)25(6,7)35-26/h10-15,18,20H,9H2,1-8H3,(H,27,28)(H,29,31)(H,30,32) |
| InChIKey | AQGMAARYVBZHQZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|