C29H47BN4O4 — CID 144563584
2-acetamido-N-ethyl-3-methyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propyl]butanamide;ethane (PubChem CID 144563584) has the molecular formula C29H47BN4O4 and a molecular weight of 526.53 g/mol. Its IUPAC name is 2-acetamido-N-ethyl-3-methyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propyl]butanamide;ethane.
| Compound Name | 2-acetamido-N-ethyl-3-methyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propyl]butanamide;ethane |
|---|---|
| PubChem CID | 144563584 |
| Molecular Formula | C29H47BN4O4 |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | 2-acetamido-N-ethyl-3-methyl-N-[1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]propyl]butanamide;ethane |
| SMILES | CC.CCC(c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)N(CC)C(=O)C(NC(C)=O)C(C)C |
| InChI | InChI=1S/C27H41BN4O4.C2H6/c1-10-22(32(11-2)25(34)23(17(3)4)30-18(5)33)24-29-16-21(31-24)19-12-14-20(15-13-19)28-35-26(6,7)27(8,9)36-28;1-2/h12-17,22-23H,10-11H2,1-9H3,(H,29,31)(H,30,33);1-2H3 |
| InChIKey | OYRNKYWFONHXLY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|