C27H41BN4O4 — CID 151485558
1-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-2-(methylamino)butan-1-one (PubChem CID 151485558) has the molecular formula C27H41BN4O4 and a molecular weight of 496.46 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-2-(methylamino)butan-1-one.
| Compound Name | 1-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-2-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 151485558 |
| Molecular Formula | C27H41BN4O4 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 1-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-2-(methylamino)butan-1-one |
| SMILES | CNC(C(=O)N1CC(COC)CC1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)C |
| InChI | InChI=1S/C27H41BN4O4/c1-17(2)23(29-7)25(33)32-15-18(16-34-8)13-22(32)24-30-14-21(31-24)19-9-11-20(12-10-19)28-35-26(3,4)27(5,6)36-28/h9-12,14,17-18,22-23,29H,13,15-16H2,1-8H3,(H,30,31) |
| InChIKey | PNJOHVCOPFIUPE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|