C31H45BN4O6 — CID 123626366
methyl N-[2-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]ethanimidate (PubChem CID 123626366) has the molecular formula C31H45BN4O6 and a molecular weight of 580.54 g/mol. Its IUPAC name is methyl N-[2-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]ethanimidate.
| Compound Name | methyl N-[2-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]ethanimidate |
|---|---|
| PubChem CID | 123626366 |
| Molecular Formula | C31H45BN4O6 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | methyl N-[2-[4-(methoxymethyl)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-(oxan-4-yl)-2-oxoethyl]ethanimidate |
| SMILES | COCC1CC(c2ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]2)N(C(=O)C(/N=C(\C)OC)C2CCOCC2)C1 |
| InChI | InChI=1S/C31H45BN4O6/c1-20(39-7)34-27(23-12-14-40-15-13-23)29(37)36-18-21(19-38-6)16-26(36)28-33-17-25(35-28)22-8-10-24(11-9-22)32-41-30(2,3)31(4,5)42-32/h8-11,17,21,23,26-27H,12-16,18-19H2,1-7H3,(H,33,35)/b34-20+ |
| InChIKey | MREMBBWJFSRBLF-QXUDOOCXSA-N |
| XLogP | 3.77 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|