C20H26BN3O4 — CID 66848089
(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 66848089) has the molecular formula C20H26BN3O4 and a molecular weight of 383.26 g/mol. Its IUPAC name is (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66848089 |
| Molecular Formula | C20H26BN3O4 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(-c3cnc([C@@H]4CCCN4C(=O)O)[nH]3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H26BN3O4/c1-19(2)20(3,4)28-21(27-19)14-9-7-13(8-10-14)15-12-22-17(23-15)16-6-5-11-24(16)18(25)26/h7-10,12,16H,5-6,11H2,1-4H3,(H,22,23)(H,25,26)/t16-/m0/s1 |
| InChIKey | CRFISUQRPNRFEN-INIZCTEOSA-N |
| XLogP | 3.19 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|