C24H34BN3O4 — CID 67432060
butyl 2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 67432060) has the molecular formula C24H34BN3O4 and a molecular weight of 439.37 g/mol. Its IUPAC name is butyl 2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | butyl 2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67432060 |
| Molecular Formula | C24H34BN3O4 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | butyl 2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1 |
| InChI | InChI=1S/C24H34BN3O4/c1-6-7-15-30-22(29)28-14-8-9-20(28)21-26-16-19(27-21)17-10-12-18(13-11-17)25-31-23(2,3)24(4,5)32-25/h10-13,16,20H,6-9,14-15H2,1-5H3,(H,26,27) |
| InChIKey | IACHIGOLWXYBQI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|