C12H18IN3O2 — CID 67151235
butyl 2-(5-iodo-1H-imidazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 67151235) has the molecular formula C12H18IN3O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is butyl 2-(5-iodo-1H-imidazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | butyl 2-(5-iodo-1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67151235 |
| Molecular Formula | C12H18IN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | butyl 2-(5-iodo-1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC1c1ncc(I)[nH]1 |
| InChI | InChI=1S/C12H18IN3O2/c1-2-3-7-18-12(17)16-6-4-5-9(16)11-14-8-10(13)15-11/h8-9H,2-7H2,1H3,(H,14,15) |
| InChIKey | KGWCQKGDXIQYEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|