C14H19N3O2 — CID 123539346
2-methylpropyl 2-(5-ethynyl-1H-imidazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 123539346) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-methylpropyl 2-(5-ethynyl-1H-imidazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | 2-methylpropyl 2-(5-ethynyl-1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123539346 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-methylpropyl 2-(5-ethynyl-1H-imidazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C#Cc1cnc(C2CCCN2C(=O)OCC(C)C)[nH]1 |
| InChI | InChI=1S/C14H19N3O2/c1-4-11-8-15-13(16-11)12-6-5-7-17(12)14(18)19-9-10(2)3/h1,8,10,12H,5-7,9H2,2-3H3,(H,15,16) |
| InChIKey | WIVXBWAOWOFVJY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|