C19H27N3O2Si — CID 140776184
tert-butyl (2S)-2-[5-(4-trimethylsilylbuta-1,3-diynyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 140776184) has the molecular formula C19H27N3O2Si and a molecular weight of 357.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-(4-trimethylsilylbuta-1,3-diynyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-(4-trimethylsilylbuta-1,3-diynyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140776184 |
| Molecular Formula | C19H27N3O2Si |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl (2S)-2-[5-(4-trimethylsilylbuta-1,3-diynyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(C#CC#C[Si](C)(C)C)[nH]1 |
| InChI | InChI=1S/C19H27N3O2Si/c1-19(2,3)24-18(23)22-12-9-11-16(22)17-20-14-15(21-17)10-7-8-13-25(4,5)6/h14,16H,9,11-12H2,1-6H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | SYXZXJLRZPPEBH-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|