C31H35N3O2Si — CID 140776199
tert-butyl (2S)-2-[5-[3-phenyl-4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 140776199) has the molecular formula C31H35N3O2Si and a molecular weight of 509.73 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[3-phenyl-4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[3-phenyl-4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140776199 |
| Molecular Formula | C31H35N3O2Si |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | tert-butyl (2S)-2-[5-[3-phenyl-4-(4-trimethylsilylbuta-1,3-diynyl)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1ncc(-c2ccc(C#CC#C[Si](C)(C)C)c(-c3ccccc3)c2)[nH]1 |
| InChI | InChI=1S/C31H35N3O2Si/c1-31(2,3)36-30(35)34-19-12-16-28(34)29-32-22-27(33-29)25-18-17-24(15-10-11-20-37(4,5)6)26(21-25)23-13-8-7-9-14-23/h7-9,13-14,17-18,21-22,28H,12,16,19H2,1-6H3,(H,32,33)/t28-/m0/s1 |
| InChIKey | HIOYOFDEHNCYKV-NDEPHWFRSA-N |
| XLogP | 7.05 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|