C21H29BN4O3 — CID 123265872
2-amino-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 123265872) has the molecular formula C21H29BN4O3 and a molecular weight of 396.30 g/mol. Its IUPAC name is 2-amino-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123265872 |
| Molecular Formula | C21H29BN4O3 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-amino-1-[2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1(C)OB(c2ccc(-c3cnc(C4CCCN4C(=O)CN)[nH]3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H29BN4O3/c1-20(2)21(3,4)29-22(28-20)15-9-7-14(8-10-15)16-13-24-19(25-16)17-6-5-11-26(17)18(27)12-23/h7-10,13,17H,5-6,11-12,23H2,1-4H3,(H,24,25) |
| InChIKey | QXDDJJURLUODEX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|