C27H38BN3O6 — CID 144593898
2-methoxy-3-methyl-1-[8-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-1-one (PubChem CID 144593898) has the molecular formula C27H38BN3O6 and a molecular weight of 511.43 g/mol. Its IUPAC name is 2-methoxy-3-methyl-1-[8-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-1-one.
| Compound Name | 2-methoxy-3-methyl-1-[8-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-1-one |
|---|---|
| PubChem CID | 144593898 |
| Molecular Formula | C27H38BN3O6 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 2-methoxy-3-methyl-1-[8-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-1-one |
| SMILES | COC(C(=O)N1CC2(CC1c1ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)[nH]1)OCCO2)C(C)C |
| InChI | InChI=1S/C27H38BN3O6/c1-17(2)22(33-7)24(32)31-16-27(34-12-13-35-27)14-21(31)23-29-15-20(30-23)18-8-10-19(11-9-18)28-36-25(3,4)26(5,6)37-28/h8-11,15,17,21-22H,12-14,16H2,1-7H3,(H,29,30) |
| InChIKey | JHAQZLYGBRIPFI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|