C26H37BN4O7 — CID 77473891
methyl N-[3-methyl-1-oxo-1-[8-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate (PubChem CID 77473891) has the molecular formula C26H37BN4O7 and a molecular weight of 528.42 g/mol. Its IUPAC name is methyl N-[3-methyl-1-oxo-1-[8-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-oxo-1-[8-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 77473891 |
| Molecular Formula | C26H37BN4O7 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | methyl N-[3-methyl-1-oxo-1-[8-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CC2(CC1c1nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3[nH]1)OCCO2)C(C)C |
| InChI | InChI=1S/C26H37BN4O7/c1-15(2)20(30-23(33)34-7)22(32)31-14-26(35-10-11-36-26)13-19(31)21-28-17-9-8-16(12-18(17)29-21)27-37-24(3,4)25(5,6)38-27/h8-9,12,15,19-20H,10-11,13-14H2,1-7H3,(H,28,29)(H,30,33) |
| InChIKey | IYMZMPVMWABWOQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|