C28H41BN4O5 — CID 78002094
methyl N-[3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]butan-2-yl]carbamate (PubChem CID 78002094) has the molecular formula C28H41BN4O5 and a molecular weight of 524.47 g/mol. Its IUPAC name is methyl N-[3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 78002094 |
| Molecular Formula | C28H41BN4O5 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | methyl N-[3-methyl-1-oxo-1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1C(c2nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3[nH]2)CC2CCCCC21)C(C)C |
| InChI | InChI=1S/C28H41BN4O5/c1-16(2)23(32-26(35)36-7)25(34)33-21-11-9-8-10-17(21)14-22(33)24-30-19-13-12-18(15-20(19)31-24)29-37-27(3,4)28(5,6)38-29/h12-13,15-17,21-23H,8-11,14H2,1-7H3,(H,30,31)(H,32,35) |
| InChIKey | ASCNLISNAYEUJC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|