C25H35BN4O5 — CID 90137472
methyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate (PubChem CID 90137472) has the molecular formula C25H35BN4O5 and a molecular weight of 482.39 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 90137472 |
| Molecular Formula | C25H35BN4O5 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(3S)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-2-azabicyclo[3.1.0]hexan-2-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1C2CC2C[C@H]1c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1)C(C)C |
| InChI | InChI=1S/C25H35BN4O5/c1-13(2)20(29-23(32)33-7)22(31)30-18-10-14(18)11-19(30)21-27-16-9-8-15(12-17(16)28-21)26-34-24(3,4)25(5,6)35-26/h8-9,12-14,18-20H,10-11H2,1-7H3,(H,27,28)(H,29,32)/t14?,18?,19-,20-/m0/s1 |
| InChIKey | VFLBMFQTENHOLV-FJZQGJIISA-N |
| XLogP | 2.90 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|