C27H39BN4O5S — CID 123500596
methyl N-[3-methyl-1-[4-methylsulfanyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 123500596) has the molecular formula C27H39BN4O5S and a molecular weight of 542.51 g/mol. Its IUPAC name is methyl N-[3-methyl-1-[4-methylsulfanyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-[4-methylsulfanyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123500596 |
| Molecular Formula | C27H39BN4O5S |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | methyl N-[3-methyl-1-[4-methylsulfanyl-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CC(SC)CC1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)C |
| InChI | InChI=1S/C27H39BN4O5S/c1-16(2)22(31-25(34)35-7)24(33)32-15-19(38-8)13-21(32)23-29-14-20(30-23)17-9-11-18(12-10-17)28-36-26(3,4)27(5,6)37-28/h9-12,14,16,19,21-22H,13,15H2,1-8H3,(H,29,30)(H,31,34) |
| InChIKey | LMWUWFQHVRWBGI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|