C26H26N4O2 — CID 155796420
benzyl 4-methyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine-1-carboxylate (PubChem CID 155796420) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is benzyl 4-methyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-methyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155796420 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | benzyl 4-methyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OCc2ccccc2)C(c2ncc(-c3ccc4ccccc4c3)[nH]2)C1 |
| InChI | InChI=1S/C26H26N4O2/c1-29-13-14-30(26(31)32-18-19-7-3-2-4-8-19)24(17-29)25-27-16-23(28-25)22-12-11-20-9-5-6-10-21(20)15-22/h2-12,15-16,24H,13-14,17-18H2,1H3,(H,27,28) |
| InChIKey | BXVWGTQWFHIHEA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |