C29H36BN3O4 — CID 66981881
tert-butyl 3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 66981881) has the molecular formula C29H36BN3O4 and a molecular weight of 501.44 g/mol. Its IUPAC name is tert-butyl 3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl 3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 66981881 |
| Molecular Formula | C29H36BN3O4 |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | tert-butyl 3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(c2ncc(-c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)[nH]2)CC2CC21 |
| InChI | InChI=1S/C29H36BN3O4/c1-27(2,3)35-26(34)33-23-14-20(23)15-24(33)25-31-16-22(32-25)19-9-8-18-13-21(11-10-17(18)12-19)30-36-28(4,5)29(6,7)37-30/h8-13,16,20,23-24H,14-15H2,1-7H3,(H,31,32) |
| InChIKey | APZGZMXQBKJIEH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|