C35H40BNO4 — CID 159378795
tert-butyl (1R,3S,5R)-3-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-inden-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 159378795) has the molecular formula C35H40BNO4 and a molecular weight of 549.52 g/mol. Its IUPAC name is tert-butyl (1R,3S,5R)-3-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-inden-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,5R)-3-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-inden-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 159378795 |
| Molecular Formula | C35H40BNO4 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | tert-butyl (1R,3S,5R)-3-[6-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-inden-2-yl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C1=Cc2ccc(-c3ccc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c3)cc2C1 |
| InChI | InChI=1S/C35H40BNO4/c1-33(2,3)39-32(38)37-30(19-28-20-31(28)37)27-16-24-10-8-22(15-26(24)17-27)21-9-11-25-18-29(13-12-23(25)14-21)36-40-34(4,5)35(6,7)41-36/h8-16,18,28,30-31H,17,19-20H2,1-7H3/t28-,30-,31+/m0/s1 |
| InChIKey | WCLZGDFJVNYIIQ-LHGWWSMPSA-N |
| XLogP | 7.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|