C28H36BN3O5 — CID 58316134
tert-butyl (3R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]morpholine-4-carboxylate (PubChem CID 58316134) has the molecular formula C28H36BN3O5 and a molecular weight of 505.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 58316134 |
| Molecular Formula | C28H36BN3O5 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | tert-butyl (3R)-3-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-1H-imidazol-2-yl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@H]1c1ncc(-c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)[nH]1 |
| InChI | InChI=1S/C28H36BN3O5/c1-26(2,3)35-25(33)32-12-13-34-17-23(32)24-30-16-22(31-24)20-9-8-19-15-21(11-10-18(19)14-20)29-36-27(4,5)28(6,7)37-29/h8-11,14-16,23H,12-13,17H2,1-7H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | HAQNIIQHCLIMLZ-QHCPKHFHSA-N |
| XLogP | 4.84 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|