C37H42BN3O5 — CID 86708729
tert-butyl (1S,3R)-3-[6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-benzo[c]chromen-3-yl]-1H-benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 86708729) has the molecular formula C37H42BN3O5 and a molecular weight of 619.57 g/mol. Its IUPAC name is tert-butyl (1S,3R)-3-[6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-benzo[c]chromen-3-yl]-1H-benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S,3R)-3-[6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-benzo[c]chromen-3-yl]-1H-benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 86708729 |
| Molecular Formula | C37H42BN3O5 |
| Molecular Weight | 619.57 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | tert-butyl (1S,3R)-3-[6-[8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-benzo[c]chromen-3-yl]-1H-benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CCC(C2)[C@@H]1c1nc2ccc(-c3ccc4c(c3)OCc3cc(B5OC(C)(C)C(C)(C)O5)ccc3-4)cc2[nH]1 |
| InChI | InChI=1S/C37H42BN3O5/c1-35(2,3)44-34(42)41-26-12-8-23(17-26)32(41)33-39-29-15-10-21(18-30(29)40-33)22-9-13-28-27-14-11-25(16-24(27)20-43-31(28)19-22)38-45-36(4,5)37(6,7)46-38/h9-11,13-16,18-19,23,26,32H,8,12,17,20H2,1-7H3,(H,39,40)/t23?,26-,32+/m0/s1 |
| InChIKey | IMZPJMYGBNNHPQ-BRZAFGOOSA-N |
| XLogP | 7.55 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.57 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|