C30H34BN3O4 — CID 154431153
3-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 154431153) has the molecular formula C30H34BN3O4 and a molecular weight of 511.43 g/mol. Its IUPAC name is 3-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 154431153 |
| Molecular Formula | C30H34BN3O4 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 3-[5-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9,10-dihydrophenanthren-2-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCc2cc(-c4cnc(C5C6CCC(C6)N5C(=O)O)[nH]4)ccc2-3)OC1(C)C |
| InChI | InChI=1S/C30H34BN3O4/c1-29(2)30(3,4)38-31(37-29)21-9-12-24-18(14-21)6-5-17-13-19(8-11-23(17)24)25-16-32-27(33-25)26-20-7-10-22(15-20)34(26)28(35)36/h8-9,11-14,16,20,22,26H,5-7,10,15H2,1-4H3,(H,32,33)(H,35,36) |
| InChIKey | SGPGYOOLNGOHBY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|