C30H43BN4O5 — CID 123723738
tert-butyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate (PubChem CID 123723738) has the molecular formula C30H43BN4O5 and a molecular weight of 550.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 123723738 |
| Molecular Formula | C30H43BN4O5 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | tert-butyl N-[(2S)-3,3-dimethyl-1-oxo-1-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]-2,5-dihydropyrrol-1-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)N1CC=C[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)C(C)(C)C |
| InChI | InChI=1S/C30H43BN4O5/c1-27(2,3)23(34-26(37)38-28(4,5)6)25(36)35-17-11-12-22(35)24-32-18-21(33-24)19-13-15-20(16-14-19)31-39-29(7,8)30(9,10)40-31/h11-16,18,22-23H,17H2,1-10H3,(H,32,33)(H,34,37)/t22-,23+/m0/s1 |
| InChIKey | HIJPYWWDFVVFPJ-XZOQPEGZSA-N |
| XLogP | 4.75 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|