C33H35BN4O5 — CID 144971091
methyl N-[(1R)-2-oxo-1-phenyl-2-[2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate (PubChem CID 144971091) has the molecular formula C33H35BN4O5 and a molecular weight of 578.48 g/mol. Its IUPAC name is methyl N-[(1R)-2-oxo-1-phenyl-2-[2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 144971091 |
| Molecular Formula | C33H35BN4O5 |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | methyl N-[(1R)-2-oxo-1-phenyl-2-[2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]-2,5-dihydropyrrol-1-yl]ethyl]carbamate |
| SMILES | COC(=O)N[C@@H](C(=O)N1CC=CC1c1nc2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C33H35BN4O5/c1-32(2)33(3,4)43-34(42-32)24-16-13-21(14-17-24)23-15-18-25-26(20-23)36-29(35-25)27-12-9-19-38(27)30(39)28(37-31(40)41-5)22-10-7-6-8-11-22/h6-18,20,27-28H,19H2,1-5H3,(H,35,36)(H,37,40)/t27?,28-/m1/s1 |
| InChIKey | LCKFPVUYMRQORY-PLYLYKGUSA-N |
| XLogP | 5.07 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|