C26H43BN4O5 — CID 144594053
ethane;methyl N-[2-oxo-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate;propane (PubChem CID 144594053) has the molecular formula C26H43BN4O5 and a molecular weight of 502.47 g/mol. Its IUPAC name is ethane;methyl N-[2-oxo-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate;propane.
| Compound Name | ethane;methyl N-[2-oxo-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate;propane |
|---|---|
| PubChem CID | 144594053 |
| Molecular Formula | C26H43BN4O5 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | ethane;methyl N-[2-oxo-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate;propane |
| SMILES | CC.CCC.COC(=O)NCC(=O)N1CCCC1c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1 |
| InChI | InChI=1S/C21H29BN4O5.C3H8.C2H6/c1-20(2)21(3,4)31-22(30-20)13-8-9-14-15(11-13)25-18(24-14)16-7-6-10-26(16)17(27)12-23-19(28)29-5;1-3-2;1-2/h8-9,11,16H,6-7,10,12H2,1-5H3,(H,23,28)(H,24,25);3H2,1-2H3;1-2H3 |
| InChIKey | IYRVYDKZQOEQOP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|