C18H25BN2O2 — CID 58449522
2-cyclopentyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole (PubChem CID 58449522) has the molecular formula C18H25BN2O2 and a molecular weight of 312.22 g/mol. Its IUPAC name is 2-cyclopentyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole.
| Compound Name | 2-cyclopentyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 58449522 |
| Molecular Formula | C18H25BN2O2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-cyclopentyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole |
| SMILES | CC1(C)OB(c2ccc3nc(C4CCCC4)[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C18H25BN2O2/c1-17(2)18(3,4)23-19(22-17)13-9-10-14-15(11-13)21-16(20-14)12-7-5-6-8-12/h9-12H,5-8H2,1-4H3,(H,20,21) |
| InChIKey | UHEHZXSWHJQJEW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|