C17H22BF2N3O2 — CID 144634298
2-(4,4-difluoropyrrolidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole (PubChem CID 144634298) has the molecular formula C17H22BF2N3O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 2-(4,4-difluoropyrrolidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole.
| Compound Name | 2-(4,4-difluoropyrrolidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 144634298 |
| Molecular Formula | C17H22BF2N3O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-(4,4-difluoropyrrolidin-2-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole |
| SMILES | CC1(C)OB(c2ccc3nc(C4CC(F)(F)CN4)[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C17H22BF2N3O2/c1-15(2)16(3,4)25-18(24-15)10-5-6-11-12(7-10)23-14(22-11)13-8-17(19,20)9-21-13/h5-7,13,21H,8-9H2,1-4H3,(H,22,23) |
| InChIKey | PARARFVSJPDJFV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|