C30H38BN3O2 — CID 90137312
2-[(2S)-pyrrolidin-2-yl]-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-benzimidazole (PubChem CID 90137312) has the molecular formula C30H38BN3O2 and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidin-2-yl]-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-benzimidazole.
| Compound Name | 2-[(2S)-pyrrolidin-2-yl]-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 90137312 |
| Molecular Formula | C30H38BN3O2 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 2-[(2S)-pyrrolidin-2-yl]-6-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dihydroindene-2,1'-cyclopentane]-4-yl]-1H-benzimidazole |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4nc([C@@H]5CCCN5)[nH]c4c3)c3c2CC2(CCCC2)C3)OC1(C)C |
| InChI | InChI=1S/C30H38BN3O2/c1-28(2)29(3,4)36-31(35-28)23-11-10-20(21-17-30(18-22(21)23)13-5-6-14-30)19-9-12-24-26(16-19)34-27(33-24)25-8-7-15-32-25/h9-12,16,25,32H,5-8,13-15,17-18H2,1-4H3,(H,33,34)/t25-/m0/s1 |
| InChIKey | MNCJBYWHXLDYRI-VWLOTQADSA-N |
| XLogP | 5.61 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|