C20H19N3 — CID 144601474
6-[2-(4-methylphenyl)ethynyl]-2-pyrrolidin-2-yl-1H-benzimidazole (PubChem CID 144601474) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-[2-(4-methylphenyl)ethynyl]-2-pyrrolidin-2-yl-1H-benzimidazole.
| Compound Name | 6-[2-(4-methylphenyl)ethynyl]-2-pyrrolidin-2-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 144601474 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 6-[2-(4-methylphenyl)ethynyl]-2-pyrrolidin-2-yl-1H-benzimidazole |
| SMILES | Cc1ccc(C#Cc2ccc3nc(C4CCCN4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H19N3/c1-14-4-6-15(7-5-14)8-9-16-10-11-17-19(13-16)23-20(22-17)18-3-2-12-21-18/h4-7,10-11,13,18,21H,2-3,12H2,1H3,(H,22,23) |
| InChIKey | GJGBESQCZKHPCN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|