C11H16ClN3O5S — CID 76851545
6-chloro-2-pyrrolidin-2-yl-1H-benzimidazole;sulfuric acid;hydrate (PubChem CID 76851545) has the molecular formula C11H16ClN3O5S and a molecular weight of 337.79 g/mol. Its IUPAC name is 6-chloro-2-pyrrolidin-2-yl-1H-benzimidazole;sulfuric acid;hydrate.
| Compound Name | 6-chloro-2-pyrrolidin-2-yl-1H-benzimidazole;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 76851545 |
| Molecular Formula | C11H16ClN3O5S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 6-chloro-2-pyrrolidin-2-yl-1H-benzimidazole;sulfuric acid;hydrate |
| SMILES | Clc1ccc2nc(C3CCCN3)[nH]c2c1.O.O=S(=O)(O)O |
| InChI | InChI=1S/C11H12ClN3.H2O4S.H2O/c12-7-3-4-8-10(6-7)15-11(14-8)9-2-1-5-13-9;1-5(2,3)4;/h3-4,6,9,13H,1-2,5H2,(H,14,15);(H2,1,2,3,4);1H2 |
| InChIKey | SOIOUNBGARJNRR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 146.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|