C28H28N4 — CID 58384734
2-cyclopentyl-6-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethynyl]-1H-benzimidazole (PubChem CID 58384734) has the molecular formula C28H28N4 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-cyclopentyl-6-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethynyl]-1H-benzimidazole.
| Compound Name | 2-cyclopentyl-6-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethynyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 58384734 |
| Molecular Formula | C28H28N4 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-cyclopentyl-6-[2-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]ethynyl]-1H-benzimidazole |
| SMILES | C(#Cc1ccc2nc(C3CCCC3)[nH]c2c1)c1ccc(C2=CN=C([C@@H]3CCCN3)C2)cc1 |
| InChI | InChI=1S/C28H28N4/c1-2-5-22(4-1)28-31-25-14-11-20(16-27(25)32-28)8-7-19-9-12-21(13-10-19)23-17-26(30-18-23)24-6-3-15-29-24/h9-14,16,18,22,24,29H,1-6,15,17H2,(H,31,32)/t24-/m0/s1 |
| InChIKey | XDQJVEFJLXIXIO-DEOSSOPVSA-N |
| XLogP | 5.56 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|