C26H26N4 — CID 157338327
2-cyclopentyl-5-[4-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]buta-1,3-diynyl]-1H-imidazole (PubChem CID 157338327) has the molecular formula C26H26N4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-cyclopentyl-5-[4-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]buta-1,3-diynyl]-1H-imidazole.
| Compound Name | 2-cyclopentyl-5-[4-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]buta-1,3-diynyl]-1H-imidazole |
|---|---|
| PubChem CID | 157338327 |
| Molecular Formula | C26H26N4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-cyclopentyl-5-[4-[4-[2-[(2S)-pyrrolidin-2-yl]-3H-pyrrol-4-yl]phenyl]buta-1,3-diynyl]-1H-imidazole |
| SMILES | C(C#Cc1cnc(C2CCCC2)[nH]1)#Cc1ccc(C2=CN=C([C@@H]3CCCN3)C2)cc1 |
| InChI | InChI=1S/C26H26N4/c1(4-9-23-18-29-26(30-23)21-7-2-3-8-21)6-19-11-13-20(14-12-19)22-16-25(28-17-22)24-10-5-15-27-24/h11-14,17-18,21,24,27H,2-3,5,7-8,10,15-16H2,(H,29,30)/t24-/m0/s1 |
| InChIKey | OWXACSNZVHSBQS-DEOSSOPVSA-N |
| XLogP | 4.41 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|