C9H11N3 — CID 91164756
5-ethynyl-2-pyrrolidin-2-yl-1H-imidazole (PubChem CID 91164756) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-ethynyl-2-pyrrolidin-2-yl-1H-imidazole.
| Compound Name | 5-ethynyl-2-pyrrolidin-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 91164756 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-ethynyl-2-pyrrolidin-2-yl-1H-imidazole |
| SMILES | C#Cc1cnc(C2CCCN2)[nH]1 |
| InChI | InChI=1S/C9H11N3/c1-2-7-6-11-9(12-7)8-4-3-5-10-8/h1,6,8,10H,3-5H2,(H,11,12) |
| InChIKey | VUJBHHPXOCLKQJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|