C29H38BN3O4 — CID 123334952
tert-butyl N-[(1R,2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]cyclopentyl]carbamate (PubChem CID 123334952) has the molecular formula C29H38BN3O4 and a molecular weight of 503.45 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 123334952 |
| Molecular Formula | C29H38BN3O4 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-benzimidazol-2-yl]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H]1c1nc2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C29H38BN3O4/c1-27(2,3)35-26(34)33-22-10-8-9-21(22)25-31-23-16-13-19(17-24(23)32-25)18-11-14-20(15-12-18)30-36-28(4,5)29(6,7)37-30/h11-17,21-22H,8-10H2,1-7H3,(H,31,32)(H,33,34)/t21-,22+/m0/s1 |
| InChIKey | PIIGCIBWVUPSAU-FCHUYYIVSA-N |
| XLogP | 5.69 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|