C23H36BN3O4 — CID 140809606
tert-butyl N-[(1R)-3-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]butyl]carbamate (PubChem CID 140809606) has the molecular formula C23H36BN3O4 and a molecular weight of 429.37 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 140809606 |
| Molecular Formula | C23H36BN3O4 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | tert-butyl N-[(1R)-3-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]butyl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)OC(C)(C)C)c1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2[nH]1 |
| InChI | InChI=1S/C23H36BN3O4/c1-14(2)12-18(27-20(28)29-21(3,4)5)19-25-16-11-10-15(13-17(16)26-19)24-30-22(6,7)23(8,9)31-24/h10-11,13-14,18H,12H2,1-9H3,(H,25,26)(H,27,28)/t18-/m1/s1 |
| InChIKey | QMBCRTMGJRNQIR-GOSISDBHSA-N |
| XLogP | 4.47 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|