C15H21N3O2 — CID 69315401
tert-butyl N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]carbamate (PubChem CID 69315401) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 69315401 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]carbamate |
| SMILES | Cc1ccc2nc(C(C)NC(=O)OC(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-9-6-7-11-12(8-9)18-13(17-11)10(2)16-14(19)20-15(3,4)5/h6-8,10H,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | RJZGIQCHXSALOI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |