C22H27N3O4 — CID 131748686
tert-butyl N-[(1R)-1-(6-methoxy-1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]carbamate (PubChem CID 131748686) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(6-methoxy-1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(6-methoxy-1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 131748686 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl N-[(1R)-1-(6-methoxy-1H-benzimidazol-2-yl)-2-(4-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc(C[C@@H](NC(=O)OC(C)(C)C)c2nc3ccc(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,3)29-21(26)25-19(12-14-6-8-15(27-4)9-7-14)20-23-17-11-10-16(28-5)13-18(17)24-20/h6-11,13,19H,12H2,1-5H3,(H,23,24)(H,25,26)/t19-/m1/s1 |
| InChIKey | HVBIETKUWLJZLU-LJQANCHMSA-N |
| XLogP | 4.39 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |